| Identification | Back Directory | [Name]
5-butyl-1H-benzotriazole | [CAS]
3663-24-9 | [Synonyms]
5-Butylbenzotriazole 5-n-Butylbenzotriazole 5-butyl-1H-benzotriazole 1H-Benzotriazole, 6-butyl- 5-Butyl-1H-benzotriazole 98% 5-Butyl-1H-benzo[d][1,2,3]triazole | [Molecular Formula]
C10H13N3 | [MDL Number]
MFCD22581692 | [MOL File]
3663-24-9.mol | [Molecular Weight]
175.23 |
| Chemical Properties | Back Directory | [Melting point ]
75℃ (ligroine ) | [Boiling point ]
202 °C(Press: 11 Torr) | [density ]
1.136±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [pka]
8.58±0.40(Predicted) | [InChI]
InChI=1S/C10H13N3/c1-2-3-4-8-5-6-9-10(7-8)12-13-11-9/h5-7H,2-4H2,1H3,(H,11,12,13) | [InChIKey]
ZCFMGIGLXOKMJC-UHFFFAOYSA-N | [SMILES]
N1C2=CC(CCCC)=CC=C2N=N1 | [EPA Substance Registry System]
5-Butyl-1H-benzotriazole (3663-24-9) |
| Hazard Information | Back Directory | [Uses]
As a derivative of benzotriazole, 5-butyl-1H-benzotriazole can participate in a variety of chemical reactions to synthesize novel compounds with specific functions. In scientific research and industry, it is often used to prepare fine chemicals such as dyes, bactericides, and antifungal agents, and is a basic structural unit for constructing complex organic molecular structures. | [Synthesis]
Starting with 4-n-butylaniline, 4-n-butylacetaniline was first prepared by reacting it with acetic anhydride and concentrated sulfuric acid. Subsequently, 4-n-butylacetaniline underwent a series of reactions including nitration, hydrolysis, and diazotization, ultimately yielding 5-butyl-1H-benzotriazole via a cyclization reaction. |
|
| Company Name: |
Cool Pharm, Ltd
|
| Telephone: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
| Company Name: |
BePharm Ltd
|
| Telephone: |
400-685-9117 |
| Website: |
www.bepharm.com |
|