| Identification | Back Directory | [Name]
PYRIDATE METABOLITE | [CAS]
40020-01-7 | [Synonyms]
CL 9673 pyridafol Pyridate hydroxy type PYRIDATE METABOLITE STANDARD 6-Chloro-3-phenyl-4-pyridazinol 4-Pyridazinol, 6-chloro-3-phenyl- 6-chloro-3-phenyl-1H-pyridazin-4-one 6-chloro-3-phenylpyridazin-4(1H)-one 6-Chloro-3-Phenyl-1H-Pyridazine-4-One 3-Chloro-5-hydroxy-6-phenylpyridazine | [EINECS(EC#)]
254-752-1 | [Molecular Formula]
C10H7ClN2O | [MDL Number]
MFCD00143498 | [MOL File]
40020-01-7.mol | [Molecular Weight]
206.63 |
| Chemical Properties | Back Directory | [Melting point ]
approximate 207℃(decomposition) | [Boiling point ]
408.1±40.0 °C(Predicted) | [density ]
1.363±0.06 g/cm3(Predicted) | [form ]
neat | [pka]
5.60±0.28(Predicted) | [BRN ]
744375 | [Major Application]
agriculture environmental | [InChI]
1S/C10H7ClN2O/c11-9-6-8(14)10(13-12-9)7-4-2-1-3-5-7/h1-6H,(H,12,14) | [InChIKey]
ZUSHSDOEVHPTCU-UHFFFAOYSA-N | [SMILES]
OC1=CC(Cl)=NN=C1C2=CC=CC=C2 | [LogP]
2.770 (est) |
| Hazard Information | Back Directory | [Uses]
Pyridafol is present in fungicide, herbicide and pesticide mixtures used to treat weed growth among agriculture. | [Production Methods]
The commercial synthesis of pyridafol involves a multi-step process starting with 3-chloro-5-methoxy-6-phenylpyridazine, which undergoes demethylation and hydrolysis to yield the active compound. The process typically uses reagents like sodium hydride or zinc in solvents such as isopropanol, with moderate yields. | [Mechanism of action]
Photosynthetic electron transport inhibitor at the photosystem II. | [Pesticide Type]
Herbicide; Metabolite |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Finetech Industry Limited
|
| Telephone: |
+86-27-8746-5837 +86-18627785180 |
| Website: |
https://www.finetechnology-ind.com/ |
| Company Name: |
Shaanxi Dideu Medichem Co. Ltd
|
| Telephone: |
+86-29-81139210 17389186172 |
| Website: |
https://www.chemicalbook.com/manufacturer/shaanxi-dideu-medichem-219/ |
|