| Identification | Back Directory | [Name]
BENTIROMIDE | [CAS]
41748-47-4 | [Synonyms]
BENTIROMIDE bentiromide sodium BZ-TYR-4-ABZ-OH NA SALT Bentiromide Sodium Salt BZ-TYR-4-ABZ-OH SODIUM SALT N-BENZOYL-L-TYR-4-AMINOBENZOIC ACID SODIUM N-BENZOYL-L-TYROSYL-P-AMINOBENZOIC ACID SODIUM N-BENZOYL-L-TYROSINE P-AMIDOBENZOIC ACID SODIUM BentiroMide · sodiuM salt, BTPABA · sodiuM salt N-BENZOYL-L-TYROSYL-4-AMINOBENZOIC ACID SODIUM SALT N-BENZOYL-L-TYROSYL-P-AMINOBENZOIC ACID SODIUM SALT N-BENZOYL-L-TYROSINE P-AMIDOBENZOIC ACID SODIUM SALT Bentiromide, N-Benzoyl-L-tyrosyl-4-aminobenzoic acid sodium salt sodium (S)-4-[[2-(benzoylamino)-3-(4-hydroxyphenyl)-1-oxopropyl]amino]benzoate sodium 4-[(2S)-2-[(4-carboxyphenyl)carbamoyl]-2-(phenylformamido)ethyl]benzen-1-olate 4-[[(S)-2-(Benzoylamino)-3-(4-hydroxyphenyl)-1-oxopropyl]amino]benzoic acid sodium salt N-Benzoyl-L-tyrosine p-amidobenzoic acid sodium salt lyophilized, >=98.0% (sum of enantiomers, HPLC) | [EINECS(EC#)]
255-530-7 | [Molecular Formula]
C23H21N2NaO5 | [MDL Number]
MFCD00042647 | [MOL File]
41748-47-4.mol | [Molecular Weight]
428.42 |
| Chemical Properties | Back Directory | [Melting point ]
~210 °C (dec.) | [storage temp. ]
2-8°C | [solubility ]
DMSO (Slightly), Methanol (Slightly), Water (Slightly) | [form ]
powder | [color ]
Off-White | [Optical Rotation]
[α]20/D +45±2°, c = 1% in DMF/H2O 1:1 | [Water Solubility ]
water: 0.25g/5mL, clear to slightly hazy | [InChIKey]
HEJYVLSWQWPKPQ-BDQAORGHSA-M | [SMILES]
[Na+].Oc1ccc(C[C@H](NC(=O)c2ccccc2)C(=O)Nc3ccc(cc3)C([O-])=O)cc1 |
| Hazard Information | Back Directory | [Uses]
N-Benzoyl-L-tyrosine p-amidobenzoic acid acts as a substrate for peptide hydrolases present in the human small intestinal mucosa. Its degradation to p-aminobenzoic acid helps to assess the pancreatic and renal functionality. | [General Description]
N-Benzoyl-L-tyrosine p-amidobenzoic acid acts as a substrate for peptide hydrolases present in the human small intestinal mucosa. Its degradation to p-aminobenzoic acid helps to assess the pancreatic and renal functionality. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Shanghai GL Peptide Ltd.
|
| Tel: |
+86-21-61263340; 17609490614 13764994101 |
| Website: |
https://www.chemicalbook.com/supplier/10480342/ |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
| Company Name: |
Leancare Ltd.
|
| Tel: |
+33 962096793 |
| Website: |
www.leancare.co.uk |
|