| Identification | Back Directory | [Name]
R-2-Aminoheptanoic acid | [CAS]
44902-01-4 | [Synonyms]
D-Homonorleucine Ra2-aminoheptanoicacid R-2-Aminoheptanoic acid (2R)-2-aminoheptanoic acid Heptanoic acid, 2-amino-, (2R)- REF DUPL: R-2-Aminoheptanoic acid R-2-AMinoheptanoic acid R-2-AMinoheptanoic acid | [Molecular Formula]
C7H15NO2 | [MDL Number]
MFCD08275758 | [MOL File]
44902-01-4.mol | [Molecular Weight]
145.2 |
| Chemical Properties | Back Directory | [Boiling point ]
251.0±23.0 °C(Predicted) | [density ]
1.017±0.06 g/cm3(Predicted) | [storage temp. ]
Keep in dark place,Inert atmosphere,Room temperature | [pka]
2.55±0.24(Predicted) | [InChI]
InChI=1S/C7H15NO2/c1-2-3-4-5-6(8)7(9)10/h6H,2-5,8H2,1H3,(H,9,10)/t6-/m1/s1 | [InChIKey]
RDFMDVXONNIGBC-ZCFIWIBFSA-N | [SMILES]
C(O)(=O)[C@H](N)CCCCC |
| Hazard Information | Back Directory | [Definition]
ChEBI: (2R)-aminoheptanoic acid is an alpha-amino fatty acid that is heptanoic acid substituted by an amino group at position 2 (the 2R stereoisomer). It has a role as a metabolite. It is functionally related to a heptanoic acid. |
|
| Company Name: |
Struchem Co., Ltd.
|
| Tel: |
0512-63009836 18994340901 |
| Website: |
www.beidapharma.com |
| Company Name: |
Shanghai GL Peptide Ltd.
|
| Tel: |
+86-21-61263340; 17609490614 13764994101 |
| Website: |
https://www.chemicalbook.com/supplier/10480342/ |
|