| Identification | Back Directory | [Name]
(-)-ALPHA-NEOCLOVENE | [CAS]
4545-68-0 | [Synonyms]
Neoclovene (-)-ALPHA-NEOCLOVENE (-)-alpha-Neoclovene >=95.0% (sum of enantiomers, GC) (1S,7AS)-1,2,3,6,7,7A-HEXAHYDRO-2,2,4,7A-TETRAMETHYL-1,3-ETHANO-3AH-INDENE (1s,7as)-1,2,3,6,7,7a-hexahydro-2,2,4,7a-tetramethyl-1,3a-ethano-3ah-indene 1,3a-Ethano-3aH-indene, 1,2,3,6,7,7a-hexahydro-2,2,4,7a-tetramethyl-, [1R-(1alpha,3aalpha,7aalpha)]- | [Molecular Formula]
C15H24 | [MDL Number]
MFCD00077832 | [MOL File]
4545-68-0.mol | [Molecular Weight]
204.35 |
| Chemical Properties | Back Directory | [Appearance]
colourless liquid | [Boiling point ]
256.5±7.0 °C(Predicted) | [density ]
0.951 g/mL at 20 °C(lit.)
| [refractive index ]
n20/D 1.508
| [Fp ]
114 °C | [storage temp. ]
2-8°C
| [form ]
liquid | [Stability:]
Stable. Keep cool. Store under argon. Photosensitive, protect from light. Combustible. Incompatible with strong oxidizing agents. | [Optical Rotation]
[α]20/D 79±2°, neat | [InChI]
1S/C15H24/c1-11-6-5-8-14(4)12-7-9-15(11,14)10-13(12,2)3/h6,12H,5,7-10H2,1-4H3/t12?,14-,15+/m0/s1 | [InChIKey]
ZCJQJJWNFDNQGZ-JQXSQYPDSA-N | [SMILES]
CC1=CCC[C@@]2(C)C3CC[C@@]12CC3(C)C |
| Hazard Information | Back Directory | [Chemical Properties]
colourless liquid | [Uses]
(-?)?-?α-?Neo58, clovene is a sesquiterpene obtained from ginseng (Panax sp.) and s considered a volatile compound and contributes to a strong aroma. Used in traditional Chinese medicine. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
ChromaDex
|
| Tel: |
949 419 0288 |
| Website: |
www.chromadex.com |
|