| Identification | Back Directory | [Name]
5,24(28)-Cholestadien-24-methylen-3beta-ol | [CAS]
474-63-5 | [Synonyms]
Nsc 232664 Chalinasterol Cholesterol, 24-methylene- Ergosta-5,24(28)-dien-3β-ol Ergosta-5,24(28)-dien-3beta-ol 5α-Ergosta-5,24(28)-dien-3β-ol Cholesterol 24-Methylene Impurity Ergosta-5,24(28)-dien-3-ol, (3β)- Ergosta-5,24(28)-dien-3beta-ol (8ci) 24-Methylcholesta-5,24(28)-dien-3β-ol 24-METHYLENECHOLESTEROL-3-SULFATE SODIUM Ergosta-5,24(28)-dien-3-ol, (3beta)- (9ci) | [Molecular Formula]
C28H46O | [MOL File]
474-63-5.mol | [Molecular Weight]
398.66 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [solubility ]
Chloroform (Slightly), Methanol (Slightly, Heated) | [form ]
Solid | [color ]
White | [InChIKey]
INDVLXYUCBVVKW-PXBBAZSNSA-N | [SMILES]
CC1(CC[C@H](O)C2)C2=CCC3C1CCC4(C)C3CCC4C(CCC(C(C)C)=C)C |
| Hazard Information | Back Directory | [Uses]
Ostreasterol is a marine steroid, and also a derivative compound of hydroxycholesterol (H918040), which functions as the main cholesterol elimination product of the brain and was found to be increased in serum of Alzheimer patients. | [Definition]
ChEBI: A 3beta-sterol having the structure of cholesterol with a methylene group at C-24. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
| Company Name: |
BOC Sciences
|
| Tel: |
|
| Website: |
https://www.bocsci.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|