| Identification | Back Directory | [Name]
Methyl 3-broMocyclobutane-1-carboxylate | [CAS]
4935-00-6 | [Synonyms]
Methyl 3-bromocyclobutanecarboxylate Methyl 3-broMocyclobutane-1-carboxylate 3-Brom-cyclobutan-carbonsaeure-methylester Methyl 3-bromocyclobutane-1-carboxylate - M10924 Cyclobutanecarboxylic acid, 3-bromo-, methyl ester Methyl 3-Bromocyclobutane-1-carboxylate (cis- and trans- mixture) | [Molecular Formula]
C6H9BrO2 | [MDL Number]
MFCD20625735 | [MOL File]
4935-00-6.mol | [Molecular Weight]
193.038 |
| Chemical Properties | Back Directory | [Boiling point ]
193.8±33.0 °C(Predicted) | [density ]
1.570±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Store in freezer, under -20°C | [Appearance]
Colorless to light yellow Liquid | [InChI]
InChI=1S/C6H9BrO2/c1-9-6(8)4-2-5(7)3-4/h4-5H,2-3H2,1H3 | [InChIKey]
PXUHGFNZFJXRFN-UHFFFAOYSA-N | [SMILES]
C1(C(OC)=O)CC(Br)C1 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
SPIRO PHARMA
|
| Tel: |
|
| Website: |
www.spiropharma.com.cn |
|