| Identification | Back Directory | [Name]
Propanoic acid, 3-[[[(phenylmethyl)thio]thioxomethyl]thio]- | [CAS]
497931-76-7 | [Synonyms]
3-benzylsulfanylcarbothioylsulfanylpropanoic acid 3-[[(Benzylthio)carbonothioyl]thio]propionic Acid 3-(Benzylsulfanylthiocarbonylsulfanyl)propionic acid 3-[[[(phenylmethyl)thio]thioxomethyl]thio]-propanoic acid Propanoic acid, 3-[[[(phenylmethyl)thio]thioxomethyl]thio]- | [Molecular Formula]
C11H12O2S3 | [MOL File]
497931-76-7.mol | [Molecular Weight]
272.41 |
| Chemical Properties | Back Directory | [Melting point ]
86-88 °C(Solv: ethyl acetate (141-78-6); hexane (110-54-3)) | [Boiling point ]
500.5±39.0 °C(Predicted) | [density ]
1.366±0.06 g/cm3(Predicted) | [storage temp. ]
Store at room temperature | [form ]
powder to crystal | [pka]
4.02±0.10(Predicted) | [color ]
White to Yellow to Orange | [InChI]
InChI=1S/C11H12O2S3/c12-10(13)6-7-15-11(14)16-8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,12,13) | [InChIKey]
IJPDPFXRBLNDPQ-UHFFFAOYSA-N | [SMILES]
C(O)(=O)CCSC(SCC1=CC=CC=C1)=S |
|
| Company Name: |
AF Biochem Co., Ltd.
|
| Telephone: |
+86-028-60911900 13540204019 |
| Website: |
www.afbiochem.com |
| Company Name: |
Rhawn Reagent
|
| Telephone: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
|