| Identification | Back Directory | [Name]
8-(4-CHLOROPHENYLTHIO)GUANOSINE 3',5'-CYCLIC MONOPHOSPHATE SODIUM SALT | [CAS]
51239-26-0 | [Synonyms]
pCPT-cGMP 8-PCPT-CGMP NA 8-PCPT-CGMP TEA CGMP, 8-PCPT-, NA 8-PCPT-CGMP SODIUM SALT 8-pCPT-cGMP, pCPT-cGMP 8-(4-Chlorophenylthio)guanosine3&rsquo 8-(4-chlorophenylthio)guanosine*3’:5’-cyclicmono 8-(4-CHLOROPHENYLTHIO)GUANOSINE3':5'-CYC LIC MONOPH 8-(4-CHLOROPHENYLTHIO)GUANOSINE 3':5'-CYLIC MONOPHOSPHATE SODIUM SALT 8-(4-CHLOROPHENYLTHIO)GUANOSINE 3',5'-CYCLIC MONOPHOSPHATE SODIUM SALT 8-(4-Chlorophenylthio)-guanosine-3'',5''-cyclic monophosphoric acid sodium sa 8-(4-chlorophenylthio)guanosine-3’,5’-cyclicmonophosphate(8-pcpt-cgmp),sodiumsalt | [Molecular Formula]
C16H14ClN5NaO7PS | [MDL Number]
MFCD00674888 | [MOL File]
51239-26-0.mol | [Molecular Weight]
509.79 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [solubility ]
H2O: 25 mg/mL | [form ]
powder | [color ]
white | [Water Solubility ]
H2O: 25mg/mL | [InChIKey]
REEQGIQRCDWDRA-ZBMQJGODSA-M | [SMILES]
[Na+].NC1=Nc2c(nc(Sc3ccc(Cl)cc3)n2[C@@H]4O[C@@H]5COP([O-])(=O)O[C@H]5[C@H]4O)C(=O)N1 |
| Hazard Information | Back Directory | [Uses]
8-(4-Chlorophenylthio)-guanosine 3′,5′-cyclic monophosphate sodium salt has been used to activate GMP-dependent protein kinase (PKG) in vascular smooth muscle cells (VSMCs). | [Definition]
ChEBI: 8-(4-chlorophenylthio)-cGMP.Na is an organic sodium salt that is the monosodium salt of 8-(4-chlorophenylthio)-cGMP. It has a role as a protein kinase agonist. It contains an 8-(4-chlorophenylthio)-cGMP(1-). | [Biochem/physiol Actions]
Membrane-permeable analog of cGMP that does not affect cGMP-regulated phosphodiesterase. A more potent cGMP analog than 8-Br-cGMP due to greater membrane permeability and a higher resistance to hydrolysis by phosphodiesterase. Used as a selective activator of cGMP dependent protein kinase (PKG). Found to be a very potent cyclic nucleotide-gated channel agonist. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1701258/0_EN.htm |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Enzo Biochem Inc
|
| Tel: |
Enzo Biochem Inc. 13797054060 |
| Website: |
www.enzo.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
| Company Name: |
Biorbyt Ltd.
|
| Tel: |
+44 (0)1223 859 353 |
| Website: |
http://www.biorbyt.com |
|