| Identification | Back Directory | [Name]
2-(4-chloro-3-sulphamoylbenzoyl)benzoic acid | [CAS]
5270-74-6 | [Synonyms]
Einecs 226-089-8
Chlorthalidone Impurity B
Chlorthalidone impurity A
Chlortalidone EP Impurity B
Chlorthalidone EP Impurity B
Chlorthalidone Related CoMpound A
Chlorothalidone Impurity -B(crude)
Chlorthalidone USP Related Compound A
2-(4-chloro-3-sulfaMoylbenzoyl)benzoic acid
2-(4-chloro-3-sulphamoylbenzoyl)benzoic acid
2-[3-(Aminosulfonyl)-4-chlorobenzoyl]benzoic acid
Benzoic acid,2-[3-(aminosulfonyl)-4-chlorobenzoyl]-
2-[3-(AMinosulfonyl)-4-chlorobenzoyl]-benzonic Acid
Chlortalidone Impurity 2（Chlortalidone EP Impurity B）
2-(4-chloro-3-sulfamoylbenzoyl)benzoic acid(WXC06261)
4′-Chloro-3′-sulfamoyl-2-benzophenone-2-carboxylic acid
Chlortalidone EP Impurity B (Chlorthalidone Related Compound A)
Chlorthalidone EP Impurity B/ Chlorthalidone Related Compound A (Chlorthalidone Acid)
Chlorthalidone Related Compound A (10 mg) (4'-Chloro-3'-sulfamoyl-2-benzophenone Carboxylic Acid)
Chlorthalidone Related Compound A (4''-Chloro-3''-sulfamoyl-2-benzophenone Carboxylic Acid) (1119309)
Chlorthalidone EP Impurity BQ: What is
Chlorthalidone EP Impurity B Q: What is the CAS Number of
Chlorthalidone EP Impurity B Q: What is the storage condition of
Chlorthalidone EP Impurity B Q: What are the applications of
Chlorthalidone EP Impurity B | [EINECS(EC#)]
226-089-8 | [Molecular Formula]
C14H10ClNO5S | [MDL Number]
MFCD09753828 | [MOL File]
5270-74-6.mol | [Molecular Weight]
339.75 |
| Chemical Properties | Back Directory | [Melting point ]
>207°C (dec.) | [Boiling point ]
638.6±65.0 °C(Predicted) | [density ]
1.537±0.06 g/cm3(Predicted) | [storage temp. ]
Hygroscopic, -20°C Freezer, Under inert atmosphere | [solubility ]
DMSO (Slightly), Methanol (Slightly) | [form ]
Solid | [pka]
3.20±0.36(Predicted) | [color ]
White to Pale Beige | [Stability:]
Hygroscopic | [Major Application]
pharmaceutical
pharmaceutical small molecule | [InChI]
1S/C14H10ClNO5S/c15-11-6-5-8(7-12(11)22(16,20)21)13(17)9-3-1-2-4-10(9)14(18)19/h1-7H,(H,18,19)(H2,16,20,21) | [InChIKey]
UKRADWWBRBBJLZ-UHFFFAOYSA-N | [SMILES]
[S](=O)(=O)(N)c1c(ccc(c1)C(=O)c2c(cccc2)C(=O)O)Cl |
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Telephone: |
18210857532 18210857532 |
| Website: |
https://www.jkchemical.com |
| Company Name: |
BioPharmaMatrix,Inc.
|
| Telephone: |
0510-86010668 13395169561; |
| Website: |
http://www.biopharmamatrix.com |
| Company Name: |
Wuxi AppTec
|
| Telephone: |
022-59987777 13552403979 |
| Website: |
www.labnetwork.com |
| Company Name: |
Labnetwork lnc.
|
| Telephone: |
+86-27-50766799 +86-18062016861 |
| Website: |
www.labnetwork.com |
| Company Name: |
sgtlifesciences pvt ltd
|
| Telephone: |
+91-8790379245 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList1846349/0.htm |
|