| Identification | Back Directory | [Name]
Sertraline EP IMpurity B | [CAS]
52758-05-1 | [Synonyms]
Sertraline EP IMpurity B Sertraline EP Impurity B HCl (1RS,4RS)-N-Methyl-4-phenyl-1,2,3,4 Sertraline hydrochloride Impurity 1 Sertraline Impurity 2(Sertraline EP Impurity B) cis-1,2,3,4-Tetrahydro-N-methyl-4-phenyl-1-naphthalenamine hydrochloride (1RS,4RS)-N-Methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine Hydrochloride (1S,4S)-N-Methyl-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamine hy drochloride (1:1) Sertraline EP Impurity BQ: What is
Sertraline EP Impurity B Q: What is the CAS Number of
Sertraline EP Impurity B Q: What is the storage condition of
Sertraline EP Impurity B Q: What are the applications of
Sertraline EP Impurity B | [Molecular Formula]
C17H20ClN | [MDL Number]
MFCD19705086 | [MOL File]
52758-05-1.mol | [Molecular Weight]
273.8 |
| Chemical Properties | Back Directory | [InChI]
InChI=1/C17H19N.ClH/c1-18-17-12-11-14(13-7-3-2-4-8-13)15-9-5-6-10-16(15)17;/h2-10,14,17-18H,11-12H2,1H3;1H/t14-,17-;/s3 | [InChIKey]
XTSOELQVDLSJFM-ZXIWTAKENA-N | [SMILES]
N([C@H]1CC[C@@H](C2C=CC=CC=2)C2=CC=CC=C12)C.Cl |&1:1,4,r| |
| Hazard Information | Back Directory | [Uses]
rac-cis-3,4-Deschlorosertraline (Sertraline EP Impurity B) is a derivative of the antidepressant compound Sertraline (S280000). It has also been studied for effects on uptake of norephinephrine. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
|