Identification | Back Directory | [Name]
1-(2,6-DIMETHYLPHENOXY)ACETONE | [CAS]
53012-41-2 | [Synonyms]
Einecs 258-292-2 Mexiletine Ketone Mexiletine impurity B Mexiletine EP Impurity B 1-(2,5-DIMETHYLPHENOXY)ACETONE 1-(2,6-DIMETHYLPHENOXY)ACETONE 1-(2,,6,-Dimethoxy)-2-Propanone 1-(2,6-Dimethylphenoxy)-2-propanone 1-(2,6-Dimethylphenoxy)propan-2-one 2-Propanone, 1-(2,6-diMethylphenoxy)- Mexiletine Hydrochloride EP Impurity B Mexiletine Hydrochloride Impurity 2(Mexiletine Hydrochloride EP Impurity B) | [EINECS(EC#)]
258-292-2 | [Molecular Formula]
C11H14O2 | [MDL Number]
MFCD00130266 | [MOL File]
53012-41-2.mol | [Molecular Weight]
178.23 |
Chemical Properties | Back Directory | [Boiling point ]
113°C/4mmHg(lit.) | [density ]
1.011±0.06 g/cm3(Predicted) | [refractive index ]
1.5060 to 1.5100 | [storage temp. ]
Refrigerator | [solubility ]
Chloroform (Slightly), Ethyl Acetate (Slightly) | [form ]
Oil | [color ]
Colourless to Orange | [InChI]
InChI=1S/C11H14O2/c1-8-5-4-6-9(2)11(8)13-7-10(3)12/h4-6H,7H2,1-3H3 | [InChIKey]
XDJULAUHYAJQBU-UHFFFAOYSA-N | [SMILES]
C(OC1=C(C)C=CC=C1C)C(=O)C | [LogP]
2.3 at 20℃ | [CAS DataBase Reference]
53012-41-2 |
|
|