| Identification | Back Directory | [Name]
METHYL 7-BROMOHEPTANOATE | [CAS]
54049-24-0 | [Synonyms]
METHYL 7-BROMOHEPTANOATE 7-BROMOHEPTANOIC ACID METHYL ESTER Heptanoic acid, 7-bromo-, methyl ester | [Molecular Formula]
C8H15BrO2 | [MDL Number]
MFCD02258672 | [MOL File]
54049-24-0.mol | [Molecular Weight]
223.11 |
| Chemical Properties | Back Directory | [Boiling point ]
112 °C(Press: 5 Torr) | [density ]
1.257 | [storage temp. ]
Sealed in dry,Room Temperature | [Appearance]
Colorless to light yellow Liquid | [InChI]
InChI=1S/C8H15BrO2/c1-11-8(10)6-4-2-3-5-7-9/h2-7H2,1H3 | [InChIKey]
BXRLUWIDTDLHQE-UHFFFAOYSA-N | [SMILES]
C(OC)(=O)CCCCCCBr |
| Hazard Information | Back Directory | [Uses]
7-Bromoheptanoic Acid-d4 Methyl Ester, is an intermediate in the preparation of labeled Tianeptine (T436800), having psychostimulant, anti-ulcer and anti-emetic properties. |
|
| Company Name: |
Alfa Aesar
|
| Telephone: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Telephone: |
0573-85285100 18627885956 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList14265/0_EN.htm |
| Company Name: |
Cool Pharm, Ltd
|
| Telephone: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
|