| Identification | Back Directory | [Name]
N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diimine | [CAS]
56222-36-7 | [Synonyms]
N,N'-bis(2,4,6-trimethylphenyl)ethanediimine N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diimine N,N'-(Ethane-1,2-diylidene)bis(2,4,6-trimethylaniline) Benzenamine, N,N'-1,2-ethanediylidenebis[2,4,6-trimethyl- (N,NE,N,NE)-N,N-(ETHANE-1,2-DIYLIDENE)BIS(2,4,6-TRIMETHYLANILINE) | [Molecular Formula]
C20H24N2 | [MDL Number]
MFCD06669905 | [MOL File]
56222-36-7.mol | [Molecular Weight]
292.418 |
| Chemical Properties | Back Directory | [Melting point ]
157 °C | [form ]
powder to crystal | [color ]
Light yellow to Yellow to Orange | [InChI]
InChI=1S/C20H24N2/c1-13-9-15(3)19(16(4)10-13)21-7-8-22-20-17(5)11-14(2)12-18(20)6/h7-12H,1-6H3 | [InChIKey]
YVKAJRYLHIECOK-UHFFFAOYSA-N | [SMILES]
C(=NC1=C(C)C=C(C)C=C1C)C=NC1=C(C)C=C(C)C=C1C |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
TCI Chemicals
|
| Tel: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|