| Identification | Back Directory | [Name]
2-(3-METHYL-3-NITROBUTYL)-1,3-DIOXOLANE | [CAS]
57620-56-1 | [Synonyms]
2-(3-METHYL-3-NITROBUTYL)-1,3-DIOXOLANE 1,3-Dioxolane, 2-(3-methyl-3-nitrobutyl)- 2-(3-Methyl-3-nitrobutyl)-1,3-dioxolane 97% | [Molecular Formula]
C8H15NO4 | [MDL Number]
MFCD00134245 | [MOL File]
57620-56-1.mol | [Molecular Weight]
189.21 |
| Chemical Properties | Back Directory | [Boiling point ]
98-99 °C/1 mmHg (lit.) | [density ]
1.13 g/mL at 25 °C (lit.) | [refractive index ]
n20/D 1.454(lit.) | [Fp ]
>230 °F | [form ]
liquid | [InChI]
1S/C8H15NO4/c1-8(2,9(10)11)4-3-7-12-5-6-13-7/h7H,3-6H2,1-2H3 | [InChIKey]
ONLCLPRCWSOGPM-UHFFFAOYSA-N | [SMILES]
CC(C)(CCC1OCCO1)[N+]([O-])=O |
| Hazard Information | Back Directory | [Uses]
2-(3-Methyl-3-nitrobutyl)-1,3-dioxolane may be used in the preparation of spin trap reagent, dimethyl-Δ′-pyrroline-1-oxide (DMPO). |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|