| Identification | Back Directory | [Name]
ACETOXYPROPYLTRIMETHOXYSILANE | [CAS]
59004-18-1 | [Synonyms]
Acetoxypropyltrimethoxsilane ACETOXYPROPYLTRIMETHOXYSILANE 3-Acetoxypropyltrimethoxysilane 3-(trimethoxysilyl)propyl acetate 3-(Trimethoxysilyl)-1-propanol acetate 1-Propanol, 3-(trimethoxysilyl)-, 1-acetate Acetic acid 3-(trimethoxysilyl)propyl ester | [EINECS(EC#)]
261-552-8 | [Molecular Formula]
C8H18O5Si | [MDL Number]
MFCD00039834 | [MOL File]
59004-18-1.mol | [Molecular Weight]
222.31 |
| Chemical Properties | Back Directory | [Melting point ]
<0°C | [Boiling point ]
92 °C | [density ]
1.062 | [refractive index ]
1.4146 | [Fp ]
93°C | [storage temp. ]
2-8°C | [Specific Gravity]
1.062 | [Hydrolytic Sensitivity]
7: reacts slowly with moisture/water | [InChI]
InChI=1S/C8H18O5Si/c1-8(9)13-6-5-7-14(10-2,11-3)12-4/h5-7H2,1-4H3 | [InChIKey]
FZTPAOAMKBXNSH-UHFFFAOYSA-N | [SMILES]
C(OC(=O)C)CC[Si](OC)(OC)OC |
|
|