| Identification | Back Directory | [Name]
4,5-DIBROMO-3-METHYL-1H-PYRAZOLE | [CAS]
5932-19-4 | [Synonyms]
MFCD00159652 3,4-Dibromo-5-methylpyrazole 3,4-DibroMo-5-Methyl-1H-pyrazole 4,5-DIBROMO-3-METHYL-1H-PYRAZOLE 1H-Pyrazole, 3,4-dibromo-5-methyl- | [Molecular Formula]
C4H4Br2N2 | [MDL Number]
MFCD00464341 | [MOL File]
5932-19-4.mol | [Molecular Weight]
239.9 |
| Chemical Properties | Back Directory | [Melting point ]
142 °C | [Boiling point ]
329.3±37.0 °C(Predicted) | [density ]
2.188±0.06 g/cm3(Predicted) | [storage temp. ]
Store at Room Tem. | [pka]
10.15±0.50(Predicted) | [InChI]
InChI=1S/C4H4Br2N2/c1-2-3(5)4(6)8-7-2/h1H3,(H,7,8) | [InChIKey]
HKWXBKMXJLNKLC-UHFFFAOYSA-N | [SMILES]
N1C(C)=C(Br)C(Br)=N1 |
| Hazard Information | Back Directory | [Uses]
3,4-Dibromo-5-methylpyrazole is a pharmaceutical intermediate that can be used as a constituent in the preparation of insecticides (tetrazolinone compounds). |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
| Company Name: |
Matrix Scientific
|
| Tel: |
803 788-9494 All other calls |
| Website: |
www.matrixscientific.com |
|