| Identification | Back Directory | [Name]
(2-hydroxyphenyl)diphenylphosphine | [CAS]
60254-10-6 | [Synonyms]
2-diphenylphosphanylphenol 2-(Diphenylphosphino)phenol Phenol, 2-(diphenylphosphino)- (2-hydroxyphenyl)diphenylphosphine (2-Hydroxyphenyl)diphenylphosphine97% (2-Hydroxyphenyl)diphenylphosphine 97% | [Molecular Formula]
C18H15OP | [MDL Number]
MFCD00015846 | [MOL File]
60254-10-6.mol | [Molecular Weight]
278.28 |
| Chemical Properties | Back Directory | [Melting point ]
142-150°C | [Boiling point ]
395.1±25.0 °C(Predicted) | [storage temp. ]
Inert atmosphere,Room Temperature | [form ]
solid | [pka]
9.33±0.30(Predicted) | [Appearance]
White to off-white Solid | [InChI]
InChI=1S/C18H15OP/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19H | [InChIKey]
HGHOYIFINVBZKO-UHFFFAOYSA-N | [SMILES]
C1(O)=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Hazard Information | Back Directory | [Uses]
Catalyst for:
- Preparation of hydroxy(phosphinoxy)biphenyls
- Formation of ethylene copolymers
- Copolymerization of ethylene with linear olefins
- Silylation of aryl halides
| [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|