| Identification | Back Directory | [Name]
Biotin-PEG11-Amine | [CAS]
604786-74-5 | [Synonyms]
Biotin-nPEG-amine Biotin-dPEG???-NH? Biotin-PEG11-Amine Biotin-dPEG(R)11-NH2 (+)-Biotin-PEG11-amine BIOTIN-DPEG(TM)(11)-NH2 NH2-peg23-NH2 Biotinamide (+)-BIOTIN-PEG11-CH2CH2NH2 | [Molecular Formula]
C34H66N4O13S | [MDL Number]
MFCD21363309 | [MOL File]
604786-74-5.mol | [Molecular Weight]
770.972 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [form ]
solid or viscous liquid | [color ]
White to off-white | [InChIKey]
SHPHAOSBFNWGAC-UHFFFAOYSA-N | [SMILES]
NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(CCCCC1C2NC(NC2CS1)=O)=O |
| Hazard Information | Back Directory | [Description]
Biotin-PEG23-amine is long chain biotinylation molecule that is reactive to carboxyl groups or 5'phosphate groups to form stable amide bonds. It is water soluble and PEG spacer increases solubility in aqueous media of the molecules conjugated to the biotin compound. It also helps to minimize steric hindrance involved with the binding to avidin molecules. | [Uses]
Biotin-nPEG-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | [reaction suitability]
reagent type: cross-linking reagent reaction type: Biotinylations |
|
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|