| Identification | Back Directory | [Name]
N-METHYL-N-PROPYLPIPERIDINIUM BIS(TRIFLUOROMETHANESULFONYL)IMIDE | [CAS]
608140-12-1 | [Synonyms]
SKL1528 SKL1539 PP13TFSI 1-METHYL-1-PROPYLPIPERIDINIUM BIS(TRIFLUOROMETHYLSULFONYL)IMIDE N-METHYL-N-PROPYLPIPERIDINIUM BIS(TRIFLUOROMETHANESULFONYL)IMIDE 1-Methyl-1-propylpiperidinium bis[(trifluoromethyl)sulfonyl]azanide PP13-TFSI(N-Methyl-N-propylpiperidiuM bis (trifluoroMethane-sulfonyl)iMide) 1-Methyl-1-propylpiperidinium bis(trifluoromethylsulfonyl)imide >=99%, H2O <=500 ppm | [Molecular Formula]
C11H20F6N2O4S2 | [MDL Number]
MFCD08458916 | [MOL File]
608140-12-1.mol | [Molecular Weight]
422.41 |
| Chemical Properties | Back Directory | [Melting point ]
8.7 °C(Solv: dichloromethane (75-09-2); water (7732-18-5)) | [density ]
1.407 g/cm3(Temp: 30 °C) | [form ]
liquid | [Major Application]
battery manufacturing | [InChI]
1S/C9H20N.C2F6NO4S2/c1-3-7-10(2)8-5-4-6-9-10;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-9H2,1-2H3;/q+1;-1 | [InChIKey]
IEFUHGXOQSVRDQ-UHFFFAOYSA-N | [SMILES]
FC(F)(F)[S](=O)(=O)[N-][S](=O)(=O)C(F)(F)F.[N+]1(CCCCC1)(CCC)C | [ECW]
5.9 V |
| Hazard Information | Back Directory | [Conductivity]
2.12 mS/cm (30 °C) | [Uses]
Ionic liquids (ILs) are molten salts with melting points lower than 100 °C. They usually consist of pair of organic cation and anion. ILs exhibit unique properties such as non-volatility, high thermal stability, and high ionic conductivity and find applications as electrolytes in lithium/sodium ion batteries and dye-sensitized solar cells. They are also used as media for synthesis of conducting polymers and intercalation electrode materials. | [General Description]
1-Methyl-1-propylpiperidinium bis(trifluoromethylsulfonyl)imide is a class of electrolytic materials that can be used in the fabrication of lithium-ion batteries. Lithium-ion batteries consist of anode, cathode, and electrolyte with a charge-discharge cycle. These materials enable the formation of greener and sustainable batteries for electrical energy storage. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
parabiochem
|
| Tel: |
025-83453382-8005 |
| Website: |
www.parabiochem.cn |
|