| Identification | Back Directory | [Name]
2,17A-DIMETHYL-17BETA-HYDROXY-5A-ANDROST-1-ENE-3-ONE | [CAS]
6176-38-1 | [Synonyms]
Nsc74234 Methylstenbolone (1.0mg/ml in Acetonitrile) 2,17A-DIMETHYL-17BETA-HYDROXY-5A-ANDROST-1-ENE-3-ONE Androst-1-en-3-one, 17-hydroxy-2,17-dimethyl-, (5α,17β)- | [Molecular Formula]
C21H32O2 | [MDL Number]
MFCD08436150 | [MOL File]
6176-38-1.mol | [Molecular Weight]
316.48 |
| Chemical Properties | Back Directory | [InChI]
InChI=1/C21H32O2/c1-13-12-19(2)14(11-18(13)22)5-6-15-16(19)7-9-20(3)17(15)8-10-21(20,4)23/h12,14-17,23H,5-11H2,1-4H3/t14-,15+,16-,17-,19-,20-,21-/s3 | [InChIKey]
TVTSDURKYARCML-MLJIMZIRNA-N | [SMILES]
C1C[C@]2([H])[C@]3(C=C(C(C[C@]3([H])CC[C@]2([C@]2([H])CC[C@](C)(O)[C@@]12C)[H])=O)C)C |&1:2,4,9,13,14,18,21,r| |
| Hazard Information | Back Directory | [Uses]
Methylstenbolone is an anabolic androgenic steroid that have been studied in respect of testosterone-receptor interaction and in the development of QSAR models. | [Definition]
ChEBI: 17beta-Hydroxy-2,17-dimethyl-5alpha-androst-1-en-3-one is a 3-hydroxy steroid. It has a role as an androgen. |
|
| Company Name: |
Finetech Industry Limited
|
| Telephone: |
+86-27-8746-5837 +86-18627785180 |
| Website: |
https://www.finetechnology-ind.com/ |
| Company Name: |
Energy Chemical
|
| Telephone: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
TargetMol
|
| Telephone: |
400-821-0310 15002144251 |
| Website: |
www.targetmol.cn/ |
| Company Name: |
RongNa Biotechnology Co.,Ltd
|
| Telephone: |
+86-86-13583358881 +8618560316533 |
| Website: |
https://www.chemicalbook.com/manufacturer/zibo-rongna-chemical-technology-403/ |
|