| Identification | Back Directory | [Name]
2-octyldecanoic acid | [CAS]
619-39-6 | [Synonyms]
EINECS 210-594-5 Dioctylacetic acid 2-octylcapric acid 2-octyldecanoic acid Decanoic acid, 2-octyl- | [EINECS(EC#)]
210-594-5 | [Molecular Formula]
C18H36O2 | [MDL Number]
MFCD00506623 | [MOL File]
619-39-6.mol | [Molecular Weight]
284.477 |
| Chemical Properties | Back Directory | [Melting point ]
38.5°C | [Boiling point ]
369.53°C (estimate) | [density ]
0.8833 (rough estimate) | [refractive index ]
1.4430 (estimate) | [form ]
<38.5°C Solid,>38.5°C Liquid | [pka]
4.82±0.40(Predicted) | [InChI]
InChI=1S/C18H36O2/c1-3-5-7-9-11-13-15-17(18(19)20)16-14-12-10-8-6-4-2/h17H,3-16H2,1-2H3,(H,19,20) | [InChIKey]
OYYXZGFIZTYYRB-UHFFFAOYSA-N | [SMILES]
C(O)(=O)C(CCCCCCCC)CCCCCCCC | [LogP]
7.674 (est) | [EPA Substance Registry System]
Decanoic acid, 2-octyl- (619-39-6) |
| Hazard Information | Back Directory | [Uses]
2-Octyldecanoic acid (Octyldecanoic acid) is a saturated fatty acid with a long aliphatic tail consisting of 17 carbon atoms and a carboxylic acid group. |
|
| Company Name: |
DebyeTec.com Inc.
|
| Tel: |
18-086626237 18086626237 |
| Website: |
www.chemicalbook.com/showsupplierproductslist16955/0.htm |
| Company Name: |
BOC Sciences
|
| Tel: |
|
| Website: |
https://www.bocsci.com |
|