| Identification | Back Directory | [Name]
2-Bromo-5-ethylthiophene | [CAS]
62323-44-8 | [Synonyms]
5-Bromo-2-ethylthiophene 2-Bromo-5-ethylthiophene Thiophene, 2-bromo-5-ethyl- | [Molecular Formula]
C6H7BrS | [MDL Number]
MFCD12033305 | [MOL File]
62323-44-8.mol | [Molecular Weight]
191.09 |
| Chemical Properties | Back Directory | [Boiling point ]
78.5 °C(Press: 11 Torr) | [density ]
1.493 | [InChI]
InChI=1S/C6H7BrS/c1-2-5-3-4-6(7)8-5/h3-4H,2H2,1H3 | [InChIKey]
HYRYQZIGBWDHAD-UHFFFAOYSA-N | [SMILES]
C1(Br)SC(CC)=CC=1 |
| Hazard Information | Back Directory | [Uses]
2-Bromo-5-ethylthiophene is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
|
|
| Company Name: |
Tcichem, Inc.
|
| Tel: |
13918644899 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList19113/0_EN.htm |
|