| Identification | Back Directory | [Name]
2,4,6-TRIS(4-FLUOROPHENYL)PYRYLIUM TETRAFLUOROBORATE | [CAS]
62497-19-2 | [Synonyms]
2,4,6-Tri-(4-fluorophenyl)pyrylium tetrafluoroborate 2,4,6-Tri-(4-fluorophenyl)pyrylium tetrafluoroborate >=95% | [Molecular Formula]
C23H14BF7O | [MDL Number]
MFCD00160151 | [MOL File]
62497-19-2.mol | [Molecular Weight]
450.156 |
| Chemical Properties | Back Directory | [Melting point ]
242-245°C | [storage temp. ]
under inert gas (nitrogen or Argon) at 2–8 °C | [form ]
powder | [Appearance]
Light yellow to yellow Solid | [InChIKey]
FRADIBPDZCOIFV-UHFFFAOYSA-N | [SMILES]
[B-](F)(F)(F)F.Fc1ccc(cc1)c2[o+]c(cc(c2)c4ccc(cc4)F)c3ccc(cc3)F |
| Hazard Information | Back Directory | [Uses]
Triarylpyrylium salt used as a photosensitizer in photocatalysis and material science. | [Definition]
ChEBI: 2,4,6-Tris(4-fluorophenyl)pyrylium tetrafluoroborate is an organofluorine compound. | [reaction suitability]
reagent type: catalyst reaction type: Photocatalysis |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|