| Identification | Back Directory | [Name]
SODIUM BENZOATE-D5 | [CAS]
62790-26-5 | [Synonyms]
SODIUM BENZOATE-D5 SODIUM BENZOATE-D5 SODIUM SALT benzoic acid-2,3,4,5,6-d5sodium salt BENZOIC-2,3,4,5,6-D5 ACID, SODIUM SALT,& | [Molecular Formula]
C7D5NaO2 | [MDL Number]
MFCD01075425 | [MOL File]
62790-26-5.mol | [Molecular Weight]
149.13 |
| Chemical Properties | Back Directory | [Melting point ]
>300 °C(lit.) | [Fp ]
121 °C | [storage temp. ]
Hygroscopic, -20°C Freezer, Under inert atmosphere | [solubility ]
Water (Slightly) | [form ]
Solid | [color ]
White to Off-White | [Stability:]
Hygroscopic | [InChI]
1S/C7H6O2.Na/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);/q;+1/p-1/i1D,2D,3D,4D,5D; | [InChIKey]
WXMKPNITSTVMEF-GWVWGMRQSA-M | [SMILES]
[Na+].[2H]c1c([2H])c([2H])c(c([2H])c1[2H])C([O-])=O |
| Hazard Information | Back Directory | [Uses]
Sodium Benzoate-d5 is a useful isotopically labeled compound for the preparation of cobalt/nickel hydroxydiphenylpropanedionate complexes and their benzoate ester derivatives. |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
Medical Isotopes
|
| Tel: |
1-(603) 635-1722 |
| Website: |
www.medicalisotopes.com |
|