| Identification | Back Directory | [Name]
Melphalan Methyl Ester HCl | [CAS]
62978-52-3 | [Synonyms]
Melphalan Impurity 8 Melphalan EP lmpurity H Melphalan Methyl Ester HCl FHKHNGPONDWSEP-ZOWNYOTGSA-N Melphalan EP Impurity H HCl Melphalan Impurity 8(Melphalan EP Impurity H) Melphalan EP Impurity H HCl (Melphalan Methyl Ester HCl) methyl 2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate | [Molecular Formula]
C14H21Cl3N2O2 | [MDL Number]
MFCD01080896 | [MOL File]
62978-52-3.mol | [Molecular Weight]
355.68 |
| Chemical Properties | Back Directory | [solubility ]
Aqueous Acid (Slightly, Heated, Sonicated), DMSO (Slightly), Methanol (Slightly) | [form ]
Sticky Solid to Solid | [color ]
Light Yellow to Dark Yellow | [Stability:]
Hygroscopic | [InChI]
InChI=1/C14H20Cl2N2O2.ClH/c1-20-14(19)13(17)10-11-2-4-12(5-3-11)18(8-6-15)9-7-16;/h2-5,13H,6-10,17H2,1H3;1H/t13-;/s3 | [InChIKey]
FHKHNGPONDWSEP-PHCOUKOGNA-N | [SMILES]
N(C1C=CC(C[C@H](N)C(=O)OC)=CC=1)(CCCl)CCCl.Cl |&1:6,r| |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
| Company Name: |
TOSUN PHARM
|
| Tel: |
61855200 13326451905 |
| Website: |
www.toref.cn/ |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|