| Identification | Back Directory | [Name]
2-(CHLOROMETHYL)ANTHRAQUINONE | [CAS]
6374-87-4 | [Synonyms]
2-(CHLOROMETHYL)ANTHRAQUINONE 2-(Chloromethyl)anthraquinone 98% 2-(chloromethyl)anthracene-9,10-dione 9,10-Anthracenedione, 2-(chloromethyl)- 2-(CHLOROMETHYL)-9,10-DIHYDROANTHRACENE-9,10-DIONE | [Molecular Formula]
C15H9ClO2 | [MDL Number]
MFCD00216612 | [MOL File]
6374-87-4.mol | [Molecular Weight]
256.68 |
| Chemical Properties | Back Directory | [Melting point ]
166-169 °C (lit.) | [form ]
solid | [BRN ]
1975355 | [InChI]
1S/C15H9ClO2/c16-8-9-5-6-12-13(7-9)15(18)11-4-2-1-3-10(11)14(12)17/h1-7H,8H2 | [InChIKey]
NVUYDKYMEMGYFP-UHFFFAOYSA-N | [SMILES]
ClCc1ccc2C(=O)c3ccccc3C(=O)c2c1 |
| Hazard Information | Back Directory | [Uses]
2-(Chloromethyl)anthraquinone may be used in the following processes:
- Synthesis of 2-[methylamino-N-(1′-methyl-4′-N,N-diethylaminobutyl)]anthraquinone diphosphate.
- Synthesis of 2-(3,4-dicyano-phenyl)-2-(9,10-dioxo-9,10-dihydroantracen-2-yl-methyl)-malonic acid diethyl ester, starting reagent for the synthesis of tetra substituted metallophthalocyanines.
- To alter the glassy carbon (GC) electrode surface in order to investigate the oxygen reduction reaction (ORR) in alkaline medium.
| [General Description]
2-(Chloromethyl)anthraquinone is an anthraquinone derivative. It was utilized as a substrate to synthesize Cibanone yellow R, a vat dye. Its electrochemical behavior has been studied over a wide pH range. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
|