| Identification | Back Directory | [Name]
(R)-1-{(S)-2-[DI(2-FURYL)PHOSPHINO]FERROCENYL}ETHYLDI(3,5-XYLYL)PHOSPHINE | [CAS]
649559-65-9 | [Synonyms]
di(3,5-xyL r-funan-xyl (R)-1-{(SP)-2-[Di(2-furyL 1,2,3,4,5-cyclopentanepentayl, compd. with 1-[(1S)-1-[bis(3,... (R)-1-{(SP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi(3,5-xylyl)phosphine (R)-1-{(SP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi(3,5-xylyl)phosphine >=97% (r,r)-1-{1-[bis(3,5-dimethylphenyl)phosphino]ethyl}-2-[di(2-furyl)phosphino]ferrocene (acc to cas) | [Molecular Formula]
C31H31O2P2.C5H5.Fe | [MDL Number]
MFCD32857263 | [MOL File]
649559-65-9.mol | [Molecular Weight]
618.471 |
| Chemical Properties | Back Directory | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [form ]
powder | [Appearance]
Light yellow to yellow Solid | [InChIKey]
RSLVVMYIUWTJGJ-KHZPMNTOSA-N | [SMILES]
[Fe].[CH]1[CH][CH][CH][CH]1.C[C@H]([C]2[CH][CH][CH][C]2P(c3ccco3)c4ccco4)P(c5cc(C)cc(C)c5)c6cc(C)cc(C)c6 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
WG reagent
|
| Tel: |
13391486464 |
| Website: |
www.wgchemical.com |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
|