| Identification | Back Directory | [Name]
Cefalexin IMpurity ( 3-aMinoMethylene-6-phenylpiperazine-2,5-dione) | [CAS]
65870-51-1 | [Synonyms]
Cephalexin IMP 3-aminomethylene-6-phenylpiperazine-2,5-dione 3-(Aminomethylene)-6-phenyl-2,5-piperazinedione 2,5-Piperazinedione, 3-(aminomethylene)-6-phenyl- 3-(aminomethylidene)-6-phenylpiperazine-2,5-dione Cefalexin IMpurity ( 3-aMinoMethylene-6-phenylpiperazine-2,5-dione) | [Molecular Formula]
C11H11N3O2 | [MOL File]
65870-51-1.mol | [Molecular Weight]
217.22 |
| Chemical Properties | Back Directory | [Boiling point ]
569.8±50.0 °C(Predicted) | [density ]
1.356±0.06 g/cm3(Predicted) | [pka]
10.07±0.40(Predicted) | [InChI]
InChI=1S/C11H11N3O2/c12-6-8-10(15)14-9(11(16)13-8)7-4-2-1-3-5-7/h1-6,9H,12H2,(H,13,16)(H,14,15) | [InChIKey]
HLLOSDFSDKAWTR-UHFFFAOYSA-N | [SMILES]
N1C(C2=CC=CC=C2)C(=O)NC(=CN)C1=O |
| Hazard Information | Back Directory | [Uses]
3-(Aminomethylene)-6-phenyl-2,5-piperazinedione, is an impurity of Cefalexin (C256800), a semi-synthetic cephalosporin antibiotic. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
|