| Identification | Back Directory | [Name]
1-Phenyl-2-(di-tert.-butyl-phosphino)-1H-pyrrole | [CAS]
672937-61-0 | [Synonyms]
cataCXium(R) PtB 95% [cataCXiuM PtB] N-Phenylpyrrol-2-yldi-tert-butylphosphine 2-(Di-tert-butylphosphino)-1-phenylpyrrole N-Phenyl-2-(di-tert-butylphosphino)pyrrole N-Phenyl-2-(di-t-butylphosphino)pyrrole,95% 2-(Di-tert-butyl-phosphino)-1-phenyl-1H-pyrrole 1-Phenyl-2-(di-tert.-butyl-phosphino)-1H-pyrrole 2-(Di-tert-butyl-phosphino)-1-phenyl-1H-pyrrole 95% 2-[bis(1,1-dimethylethyl)phosphino]-1-phenyl-1H-Pyrrole N-Phenyl-2-(di-t-butylphosphino)pyrrole, 95+% [cataCXium(R) PtB] | [Molecular Formula]
C18H26NP | [MDL Number]
MFCD05861612 | [MOL File]
672937-61-0.mol | [Molecular Weight]
287.38 |
| Chemical Properties | Back Directory | [Melting point ]
51°C | [Boiling point ]
386.3±15.0 °C(Predicted) | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [form ]
Powder | [pka]
-6.07±0.70(Predicted) | [color ]
white to yellow | [Sensitive ]
air sensitive | [BRN ]
9626114 | [InChI]
1S/C18H26NP/c1-17(2,3)20(18(4,5)6)16-13-10-14-19(16)15-11-8-7-9-12-15/h7-14H,1-6H3 | [InChIKey]
DVVDGSKDQGMLPW-UHFFFAOYSA-N | [SMILES]
CC(C)(C)P(c1cccn1-c2ccccc2)C(C)(C)C |
| Hazard Information | Back Directory | [Chemical Properties]
White to yellow powder | [General Description]
sold in collaboration with Solvias AG | [reaction suitability]
reaction type: Asymmetric synthesis reagent type: ligand reaction type: Buchwald-Hartwig Cross Coupling Reaction reagent type: ligand reaction type: Dehydrogenation reagent type: ligand reaction type: Suzuki-Miyaura Coupling |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
|