| Identification | Back Directory | [Name]
Fatty acids C14-C18 and C16-C18 unsaturated | [CAS]
67701-06-8 | [Synonyms]
FattyacidC14-C18,unsaturated Fatty acids, C14-18 and C16-18-unsatd. fatty acids, C14-18 and C16-18-unsaturated FATTY ACIDS C14-C18 AND C16-C18 UNSATURATED Fattyacids,unsaturatedC14-C18=vegetabilesOle C14-C18 and C16-C18 unsaturated alkyl carboxylic acid | [EINECS(EC#)]
266-930-6 | [Molecular Formula]
C15H16O2 | [MOL File]
67701-06-8.mol | [Molecular Weight]
228.286 |
| Chemical Properties | Back Directory | [Boiling point ]
225℃ at 10hPa | [density ]
0.84-0.89g/cm3 at 20℃ | [vapor pressure ]
0-1Pa at 20-25℃ | [form ]
Paste | [InChI]
InChI=1S/C15H16O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H,1H2,(H,16,17)/b4-3+,6-5+,8-7+,10-9+,12-11+,14-13+ | [InChIKey]
DTAMQBQGFSVRFE-IDFWPVMJSA-N | [SMILES]
C(O)(=O)/C=C/C=C/C=C/C=C/C=C/C=C/C=C | [LogP]
6.96-8.23 | [Dissociation constant]
4.75-5.02 at 25℃ | [EPA Substance Registry System]
Fatty acids, C14-18 and C16-18-unsatd. (67701-06-8) |
|
| Company Name: |
Brenntag N.V.
|
| Tel: |
+32 (56) 77.69.44 |
| Website: |
www.brenntag.be |
| Company Name: |
Chemstock Inc.
|
| Tel: |
(715) 726-1437 |
| Website: |
www.chemstock.com |
|