| Identification | Back Directory | [Name]
1,3-Dihydro-1-methyl-3-(2-oxopropylidene)-2H-Indol-2-one | [CAS]
70351-51-8 | [Synonyms]
Supercinnamaldehyde 1,3-Dihydro-1-methyl-3-(2-oxopropylidene)-2H-Indol-2-one 2H-Indol-2-one, 1,3-dihydro-1-methyl-3-(2-oxopropylidene)- | [Molecular Formula]
C12H11NO2 | [MDL Number]
MFCD08530327 | [MOL File]
70351-51-8.mol | [Molecular Weight]
201.22 |
| Chemical Properties | Back Directory | [storage temp. ]
2-8°C | [solubility ]
DMSO: soluble10mg/mL, clear | [form ]
powder | [color ]
faint red to very dark red | [InChI]
1S/C12H11NO2/c1-8(14)7-10-9-5-3-4-6-11(9)13(2)12(10)15/h3-7H,1-2H3/b10-7+ | [InChIKey]
CZKBLHCEDVWPRN-JXMROGBWSA-N | [SMILES]
CN1C(=O)C(=C\C(C)=O)\c2ccccc12 |
| Hazard Information | Back Directory | [Uses]
Supercinnamaldehyde may be used in transient receptor potential ankyrin 1 (TRPA 1)-mediated cell signaling studies. | [Biochem/physiol Actions]
Supercinnamaldehyde is a transient receptor potential ankyrin 1 (TRPA1) activator; EC50 = 0.8 μM; derivative of cinnamaldehyde; covalently binds to and activates TRPA1 receptor (expressed in nociceptive neurons) by modifying its cysteine residues. Covalent modification of reactive cysteines within TRPA1 can cause channel activation, rapidly signaling potential tissue damage through the pain pathway. |
|
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Abcam Limited
|
| Tel: |
021-2070050 400921018 |
| Website: |
www.abcam.cn |
|