| Identification | Back Directory | [Name]
2-METHYL-9-ACRIDINECARBALDEHYDE | [CAS]
70401-29-5 | [Synonyms]
TIMTEC-BB SBB000603 2-METHYL-9-ACRIDINECARBALDEHYDE 2-methylacridine-9-carbaldehyde 2-METHYL-9-ACRIDINECARBOXALDEHYDE 9-Acridinecarboxaldehyde, 2-methyl- | [EINECS(EC#)]
274-594-7 | [Molecular Formula]
C15H11NO | [MDL Number]
MFCD00005031 | [MOL File]
70401-29-5.mol | [Molecular Weight]
221.25 |
| Chemical Properties | Back Directory | [Melting point ]
145-146 °C (lit.) | [form ]
solid | [InChI]
1S/C15H11NO/c1-10-6-7-15-12(8-10)13(9-17)11-4-2-3-5-14(11)16-15/h2-9H,1H3 | [InChIKey]
PIBZGMVFXCKDER-UHFFFAOYSA-N | [SMILES]
[H]C(=O)c1c2ccccc2nc3ccc(C)cc13 |
| Hazard Information | Back Directory | [Uses]
2-Methyl-9-acridinecarboxaldehyde was used:
- in cleavage assay of rRNA by denaturing gel electrophoresis
- in the synthesis of peptide-acridine/acridone conjugates, potential anticancer, antiviral and antiprion drugs
|
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|