| Identification | Back Directory |  [Name]
  ALLYLTRIS(TRIMETHYLSILOXY)SILANE |  [CAS]
  7087-21-0 |  [Synonyms]
  ALLYLTRIS(TRIMETHYLSILOXY)SILANE Allyltris(trimethylsilyloxy)silane Allyltris(trimethylsilyloxy)silane > 3-Allyl-1,1,1,5,5,5-hexamethyl-3-((trimethylsilyl)oxy)trisiloxane Trisiloxane, 1,1,1,5,5,5-hexamethyl-3-(2-propen-1-yl)-3-[(trimethylsilyl)oxy]- |  [Molecular Formula]
  C12H32O3Si4 |  [MDL Number]
  MFCD00054804 |  [MOL File]
  7087-21-0.mol |  [Molecular Weight]
  336.72 |  
 | Chemical Properties | Back Directory |  [Melting point ]
  <0°C |  [Boiling point ]
  105 °C |  [density ]
  0.86 |  [refractive index ]
  1.4008 |  [Fp ]
  153°C |  [Water Solubility ]
  Insoluble in water |  [form ]
  clear liquid |  [color ]
  Colorless to Almost colorless |  [Specific Gravity]
  0.86 |  [Hydrolytic Sensitivity]
  2: reacts with aqueous acid |  [InChI]
  InChI=1S/C12H32O3Si4/c1-11-12-19(13-16(2,3)4,14-17(5,6)7)15-18(8,9)10/h11H,1,12H2,2-10H3 |  [InChIKey]
  WCAXVXQTTCIZHD-UHFFFAOYSA-N |  [SMILES]
  [Si](C)(C)(C)O[Si](CC=C)(O[Si](C)(C)C)O[Si](C)(C)C |  [CAS DataBase Reference]
  7087-21-0 |  
  
             | 
            
            
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
             |