| Identification | Back Directory | [Name]
11,13-Hexadecadienal,(11Z,13Z)- | [CAS]
71317-73-2 | [Synonyms]
11Z13Z-16CHO 7Z11Z13E-16CHO Nowtechnicalpheromone (Z,Z)-11,13-Hexadecadienal 11,13-Hexadecadienal, (Z,Z)- Z,Z,E-7,11,13-Hexadecatrienal (11Z,13Z)-11,13-Hexadecadienal 11,13-Hexadecadienal,(11Z,13Z)- Epa pesticide chemical code 000711 | [Molecular Formula]
C16H28O | [MOL File]
71317-73-2.mol | [Molecular Weight]
236.39 |
| Chemical Properties | Back Directory | [Boiling point ]
332.7±11.0 °C(Predicted) | [density ]
0.852±0.06 g/cm3 (20 ºC 760 Torr) | [refractive index ]
1.4768 (589.3 nm 26℃) | [InChI]
InChI=1S/C16H28O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17/h3-6,16H,2,7-15H2,1H3/b4-3-,6-5- | [InChIKey]
ZTJGMVSDMQAJPE-OUPQRBNQSA-N | [SMILES]
C(=O)CCCCCCCCC/C=C\C=C/CC | [LogP]
6.246 (est) | [EPA Substance Registry System]
(Z,Z)-11,13-Hexadecadienal (71317-73-2) |
| Hazard Information | Back Directory | [Description]
(Z,Z)-11,13-Hexadecadienal is a major component of the navel orange worm (Pamyelois transitella) pheromone. | [Definition]
ChEBI: 11Z,13Z-Hexadecadienal is a polyunsaturated fatty aldehyde. |
|
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
BOC Sciences
|
| Tel: |
|
| Website: |
https://www.bocsci.com |
|