| Identification | Back Directory | [Name]
ADENYLYLMETHYLENEDIPHOSPHONATE SODIUM SALT | [CAS]
7414-56-4 | [Synonyms]
AMP-PCP disodium AMP-PCP SODIUM SALT AMP-PCP disodium salt β,γ-Methyleneadenosine 5′-triphosphate ADENYLYLMETHYLENEDIPHOSPHONATE SODIUM SALT Adenylylmethylenediphosphonate disodium salt B-GAMMA-METHYLENEADENOSINE 5-*TRIPHOSPHA TE SODIUM β,γ-Methyleneadenosine 5μ-triphosphate disodium salt BETA,GAMMA-METHYLENEADENOSINE 5'-TRIPHOSPHATE SODIUM SALT beta,gamma-Methyleneadenosine 5'-triphosphate disodium salt Adenylylmethylenediphosphonate disodium salt, AMP-PCP disodium salt | [Molecular Formula]
C11H17N5NaO12P3 | [MDL Number]
MFCD00151405 | [MOL File]
7414-56-4.mol | [Molecular Weight]
527.19 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [solubility ]
H2O: 10 mg/mL
| [form ]
solid
| [color ]
white
| [Water Solubility ]
H2O: 10mg/mL | [InChIKey]
KZCUOVRMGTZINH-LYYWGVPGSA-L | [SMILES]
[Na+].[Na+].Nc1ncnc2n(cnc12)[C@@H]3O[C@H](COP(O)(=O)OP([O-])(=O)CP(O)([O-])=O)[C@@H](O)[C@H]3O |
| Hazard Information | Back Directory | [Uses]
β,γ-Methyleneadenosine 5′-triphosphate disodium salt has been used as an internal standard for the UDP-hexose analysis with ion pairing high performance liquid chromatography tandem mass spectrometry (HPLC-MS/MS). | [Biochem/physiol Actions]
Selective P2X purinoceptor agonist that is more potent than ATP, but less potent than α, β-methylene-L-adenosine 5′-triphosphate. | [IC 50]
HSP90: 3.8 μM (Kd) |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Rhawn Reagent
|
| Tel: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1701258/0_EN.htm |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
cjbscvictory
|
| Tel: |
13348960310 13348960310; |
| Website: |
https://www.weikeqi-biotech.com/ |
|