| Identification | Back Directory | [Name]
RHODAMINE B HYDRAZIDE | [CAS]
74317-53-6 | [Synonyms]
RHODAMINE B HYDRAZIDE
RhodaMine B Cu2+ sensor
2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one
Spiro[1H-isoindole-1,9'-[9H]xanthen]-3(2H)-one, 2-aMino-3',6'-bis(diethylaMino)- | [Molecular Formula]
C28H32N4O2 | [MDL Number]
MFCD01863110 | [MOL File]
74317-53-6.mol | [Molecular Weight]
456.58 |
| Chemical Properties | Back Directory | [Melting point ]
176-177 °C | [Boiling point ]
643.3±65.0 °C(Predicted) | [density ]
1.27±0.1 g/cm3(Predicted) | [solubility ]
DMF: 30 mg/ml; DMF:PBS(pH7.2) (1:2): 0.33 mg/ml; DMSO: 20 mg/ml; Ethanol: 0.1 mg/ml | [form ]
A crystalline solid | [pka]
6.44±0.20(Predicted) | [color ]
Off-white to yellow | [InChI]
InChI=1S/C28H32N4O2/c1-5-30(6-2)19-13-15-23-25(17-19)34-26-18-20(31(7-3)8-4)14-16-24(26)28(23)22-12-10-9-11-21(22)27(33)32(28)29/h9-18H,5-8,29H2,1-4H3 | [InChIKey]
WTDHTIVYKKLOTC-UHFFFAOYSA-N | [SMILES]
C12(C3=C(C=C(N(CC)CC)C=C3)OC3=C1C=CC(N(CC)CC)=C3)C1=C(C=CC=C1)C(=O)N2N |
| Hazard Information | Back Directory | [Uses]
Rhodamine B hydrazide is a good probe for sulfite, with colorless and non-fluorescent properties. While the emission is related to the concentration of sulfite (5-800 ng/mL; detection limit=1.4 ng/mL (3σ)). Sulfite reduces dissolved oxygen to yield superoxide radicals, which binds to Rhodamine B hydrazide to form Rhodamine B. Rhodamine B hydrazide gives Rhodamine B-like fluorescence in the presence of sulfite, which is enhanced by Tween 80 surfactant micelles. Rhodamine B hydrazide has an absorption maximum at 554 nm and a fluorescence emission maximum at 574 nm[1]. | [References]
[1] Yang X F, et al. Novel spectrofluorimetric method for the determination of sulfite with rhodamine B hydrazide in a micellar medium[J]. Analytica Chimica Acta, 2002, 456(1): 121-128. |
|
|