| Identification | Back Directory | [Name]
4,4-(1,2,4,5-tetrazine-3,6-diyl)dibenzoic acid | [CAS]
753031-26-4 | [Synonyms]
4,4-(1,2,4,5-tetrazine-3,6-diyl)dibenzoic acid Benzoic acid, 4,4'-(1,2,4,5-tetrazine-3,6-diyl)bis- | [Molecular Formula]
C16H10N4O4 | [MOL File]
753031-26-4.mol | [Molecular Weight]
322.27 |
| Chemical Properties | Back Directory | [Boiling point ]
650.7±65.0 °C(Predicted) | [density ]
1.478±0.06 g/cm3(Predicted) | [pka]
2.70±0.10(Predicted) | [InChI]
InChI=1S/C16H10N4O4/c21-15(22)11-5-1-9(2-6-11)13-17-19-14(20-18-13)10-3-7-12(8-4-10)16(23)24/h1-8H,(H,21,22)(H,23,24) | [InChIKey]
RYFVKTNONYVZPO-UHFFFAOYSA-N | [SMILES]
N1C(C2=CC=C(C=C2)C(O)=O)=NN=C(C2=CC=C(C=C2)C(O)=O)N=1 |
| Hazard Information | Back Directory | [Uses]
4,4-(1,2,4,5-Tetrazine-3,6-diyl)dibenzoic acid can be used as ligands in the synthesis of MOF materials: ZrTz-68; HfTz-68; AlTz-53. |
|
| Company Name: |
Henan Alfachem Co.,Ltd. Gold
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
|