| Identification | Back Directory | [Name]
Magnesium Acetyl Taurate | [CAS]
75350-40-2 | [Synonyms]
Magnesium Acetyl Taurate Magnesium acetyl taurinate | [EINECS(EC#)]
13995-182-4 | [Molecular Formula]
C4H11MgNO4S | [MOL File]
75350-40-2.mol | [Molecular Weight]
193.5 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C4H9NO4S.Mg.2H/c1-4(6)5-2-3-10(7,8)9;;;/h2-3H2,1H3,(H,5,6)(H,7,8,9);;; | [InChIKey]
IKIHNTLZYNOENP-UHFFFAOYSA-N | [SMILES]
C(S(O)(=O)=O)CNC(=O)C.[Mg] |
| Hazard Information | Back Directory | [Uses]
Magnesium Acetyl Taurate is a form of magnesium commonly used as a magnesium supplement. It consists of magnesium combined with acetyl taurate, which is a combination of the amino acids taurine and acetic acid. This unique combination is believed to increase the absorption and bioavailability of magnesium in the body, making it more effective than other forms of magnesium supplements. |
|
|