| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [form ]
powder | [InChI]
1S/C20H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22/h9-10,22H,2-8,11-19H2,1H3,(H,21,23)/b10-9- | [InChIKey]
BOWVQLFMWHZBEF-KTKRTIGZSA-N | [SMILES]
O=C(CCCCCCC/C=C\CCCCCCCC)NCCO |
| Hazard Information | Back Directory | [Uses]
Anandamide is an endocannabinoid. It acts as a ligand for cannabinoid (CB) receptors CB1 and CB2 in the brain and peripheral tissues. It is synthesized from glycerophospho-N-arachidonoylethanolamine (GP-NArE) precursor by the reaction catalyzed by glycerophosphodiesterase 1. | [Biological Activity]
Anandamide plays a vital role in various processes including inflammationpainand appetite. |
|
| Company Name: |
TargetMol
|
| Tel: |
400-821-0310 15002144251 |
| Website: |
www.targetmol.cn/ |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Creative Enzymes
|
| Tel: |
1-516-855-7709 |
| Website: |
www.creative-enzymes.com |
|