| Identification | Back Directory | [Name]
Chloro{2,6-bis[(phenylseleno-Se)methyl]phenyl-C}palladium(II) | [CAS]
761459-93-2 | [Synonyms]
Chloro{2,6-bis[(phenylseleno-Se)methyl]phenyl-C}palladium(II) | [Molecular Formula]
C20H19ClPdSe2 | [MDL Number]
MFCD22666457 | [MOL File]
761459-93-2.mol | [Molecular Weight]
559.18 |
| Chemical Properties | Back Directory | [Melting point ]
162-221°C | [storage temp. ]
2-8°C | [form ]
solid | [InChI]
1S/C20H17Se2.ClH.Pd/c1-3-10-19(11-4-1)21-15-17-8-7-9-18(14-17)16-22-20-12-5-2-6-13-20;;/h1-13H,15-16H2;1H;/q;;+1/p-1 | [InChIKey]
UPTIBUSNQPQCIY-UHFFFAOYSA-M | [SMILES]
Cl[Pd]c1c(C[Se]c2ccccc2)cccc1C[Se]c3ccccc3 |
| Safety Data | Back Directory | [Hazard Codes ]
T | [Risk Statements ]
23/24/25-40 | [Safety Statements ]
36/37-45 | [RIDADR ]
UN 3283 6.1 / PGIII | [WGK Germany ]
3 | [Storage Class]
6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | [Hazard Classifications]
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 2
STOT RE 2 |
| Hazard Information | Back Directory | [Uses]
Application Statement: Complex promotes the formation of alpha-amino acids and allyl alcohols through a Petasis Borono-Mannich reaction. | [reaction suitability]
core: palladium
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Telephone: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|