| Identification | Back Directory | [Name]
BICYCLO[3.3.1]NONANE-3,7-DIONE | [CAS]
770-15-0 | [Synonyms]
o[3.3.1]nonane-3,7-dione Bicyclo3.3.1none-3,7-dione BICYCLO[3.3.1]NONANE-3,7-DIONE | [Molecular Formula]
C9H12O2 | [MDL Number]
MFCD00013278 | [MOL File]
770-15-0.mol | [Molecular Weight]
152.19 |
| Chemical Properties | Back Directory | [Melting point ]
240 °C (decomp) | [Boiling point ]
283.7±33.0 °C(Predicted) | [density ]
1.138±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [form ]
powder | [InChI]
1S/C9H12O2/c10-8-2-6-1-7(4-8)5-9(11)3-6/h6-7H,1-5H2/t6-,7+ | [InChIKey]
KIKCULSOJJAIEB-KNVOCYPGSA-N | [SMILES]
O=C1C[C@H]2C[C@@H](C1)CC(=O)C2 |
| Hazard Information | Back Directory | [Uses]
The high stability and formation of the supramolecular structures of the syn and anti isomers of the dioxime of bicyclo[3.3.1]nonane-3,7-dione were studied. | [General Description]
The high stability and formation of the supramolecular structures of the syn and anti isomers of the dioxime of bicyclo[3.3.1]nonane-3,7-dione were studied. |
|
| Company Name: |
Chem-Stone Co.,Ltd.
|
| Tel: |
020-82185713,82185709 13418171485 |
| Website: |
www.chem-stone.com |
| Company Name: |
Cool Pharm, Ltd
|
| Tel: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
BePharm Ltd
|
| Tel: |
400-685-9117 |
| Website: |
www.bepharm.com |
| Company Name: |
Rhawn Reagent
|
| Tel: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
|