| Identification | Back Directory | [Name]
(4-CHLOROPHENYLETHYNYL)TRIMETHYLSILANE | [CAS]
78704-49-1 | [Synonyms]
4-Chlorophenyl(trimethylsilyl)ethyne (4-CHOROPHENYLETHYNYL)TRIMETHYLSILANE Trimethylsilyl(4-chlorophenyl)acetylene (4-Chlorophenylethynyl)trimethylsilane 97% (2-(4-chlorophenyl)ethynyl)trimethylsilane 1-(Trimethylsilyl)-2-(4-chlorophenyl)ethyne 1-Chloro-4-[(trimethylsilyl)ethynyl]benzene 1-Chloro-4-[2-(trimethylsilyl)ethynyl]benzene 1-(4-Chlorophenyl)-2-(trimethylsilyl)acetylene Benzene, 1-chloro-4-[2-(trimethylsilyl)ethynyl]- (4-Chlorophenylethynyl)trimethylsilane, 97%
white to pale brown solid | [Molecular Formula]
C6H4ClC≡CSi(CH3)3 | [MDL Number]
MFCD03427267 | [MOL File]
78704-49-1.mol | [Molecular Weight]
208.76 |
| Chemical Properties | Back Directory | [Melting point ]
47-51 °C(lit.)
| [Boiling point ]
231.2±32.0℃ (760 Torr) | [density ]
1.03±0.1 g/cm3 (20 ºC 760 Torr) | [Fp ]
220 °F
| [storage temp. ]
Store at room temperature | [form ]
Solid | [color ]
White to pale brown | [Hydrolytic Sensitivity]
4: no reaction with water under neutral conditions | [InChI]
1S/C11H13ClSi/c1-13(2,3)9-8-10-4-6-11(12)7-5-10/h4-7H,1-3H3 | [InChIKey]
HVIHXUCWKNRJTC-UHFFFAOYSA-N | [SMILES]
C[Si](C)(C)C#Cc1ccc(Cl)cc1 |
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
SPIRO PHARMA
|
| Tel: |
|
| Website: |
www.spiropharma.com.cn |
|