| Identification | Back Directory | [Name]
Pyrylium, tetrafluoroborate(1-) (1:1) | [CAS]
80279-50-1 | [Synonyms]
SKL163
Pyrylium, tetrafluoroborate(1-)
Pyrylium, tetrafluoroborate(1-) (1:1) | [Molecular Formula]
C5H5BF4O | [MDL Number]
MFCD32857267 | [MOL File]
80279-50-1.mol | [Molecular Weight]
167.9 |
| Chemical Properties | Back Directory | [storage temp. ]
2-8°C | [form ]
powder | [InChI]
1S/C5H5O.BF4/c1-2-4-6-5-3-1;2-1(3,4)5/h1-5H;/q+1;-1 | [InChIKey]
SJNICXIZTGPXAU-UHFFFAOYSA-N | [SMILES]
[B-](F)(F)(F)F.[o+]1ccccc1 |
| Hazard Information | Back Directory | [Uses]
Pyrylium tetrafluoroborate is used for the functionalization of heterocyclic amines, activating them for nucleophilic substitution. As demonstrated by the Cornella lab, the intermediate pyridinium salts can react with a vast array of nucelophiles to form new C-N, C-O, and C-S bonds, making pyrylium tetrafluoroborate a valuable reagent for late-stage functionalization. |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|