| Identification | Back Directory | [Name]
NIPRADILOL | [CAS]
81486-22-8 | [Synonyms]
K 351 KT 210 Hypadil Nipranol Nipradolol NIPRADILOL Ccris 2515 Brn 3566879 Nipradolol (10mM in DMSO) NIPRANOL;NIPRADOLOL;NIPRADILOL;BRN 3566879 8-(2-Hydroxy-3-(isopropylamino)propoxy)-3-chromanyl nitrat 8-(2-Hydroxy-3-(isopropylaMino)propoxy)chroMan-3-yl nitrate 8-(2-Hydroxy-3-(isopropylamino)propoxy)-3-chromanol 3-nitrate 8-(2-Hydroxy-3-(isopropylamino)propoxy)-3-chromanol, 3-nitrate 3,4-Dihydro-8-(2-hydroxy-3-isopropylamino)propoxy-3-nitroxy-2H-1-benzopyran 3,4-Dihydro-8-(2-hydroxy-3-(isopropylamino)propoxy)-2H-1-benzopyran-3-ol 3-nitrate 3,4-Dihydro-8-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]-2H-1-benzopyran-3-ol 3-nitrate 2H-1-Benzopyran-3-ol, 3,4-dihydro-8-(2-hydroxy-3-((1-methylethyl)amino)propoxy)-, 3-nitrate | [Molecular Formula]
C15H22N2O6 | [MDL Number]
MFCD00864678 | [MOL File]
81486-22-8.mol | [Molecular Weight]
326.34 |
| Chemical Properties | Back Directory | [Melting point ]
110-122℃ | [Boiling point ]
464.39°C (rough estimate) | [density ]
1.1829 (rough estimate) | [refractive index ]
1.6280 (estimate) | [Cosmetics Ingredients Functions]
SKIN CONDITIONING | [InChI]
InChI=1S/C15H22N2O6/c1-10(2)16-7-12(18)8-21-14-5-3-4-11-6-13(23-17(19)20)9-22-15(11)14/h3-5,10,12-13,16,18H,6-9H2,1-2H3 | [InChIKey]
OMCPLEZZPVJJIS-UHFFFAOYSA-N | [SMILES]
C1OC2=C(OCC(O)CNC(C)C)C=CC=C2CC1O[N+]([O-])=O |
| Hazard Information | Back Directory | [Description]
Nipradilol is a beta-blocker with vasodilatory activity. As an antihypertensive nipradilol
decreases systemic/pulmonary arterial blood pressure, heart rate, cardiac output and left
ventricular volume without causing tachycardia. Nipradilol is also reported to have
antiangina activity in dogs. | [Originator]
Kowa (Japan) | [Uses]
Nipradolol is a β-adrenoceptor blocking agent with antihypertensive properties.?Nipradolol is used as an?anti-glaucomatous agent. | [Definition]
ChEBI: Hypadil (TN) is an organic molecular entity. | [Brand name]
Hypadil |
|
| Company Name: |
LGM Pharma
|
| Tel: |
1-(800)-881-8210 |
| Website: |
www.lgmpharma.com |
| Company Name: |
NCE Biomedical Co.,Ltd.
|
| Tel: |
4000-027-021 |24 +86-13986109188 | +86-15623472865 | +81-08033611988 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15748/0_EN.htm |
| Company Name: |
Moltt Biocem Co., Ltd.
|
| Tel: |
+86-21-38682181 15900741819 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15856/0_EN.htm |
| Company Name: |
SPIRO PHARMA
|
| Tel: |
|
| Website: |
www.spiropharma.com.cn |
| Company Name: |
Cckinase, Inc.
|
| Tel: |
+1 (732)236-3202 |
| Website: |
www.cckinase.com |
|