| Identification | Back Directory | [Name]
ETHYL ACETOACETATE (1,2,3,4-13C4) | [CAS]
84508-55-4 | [Synonyms]
Ethyl Acetoacetate-13C4 [13C4]-Ethyl Acetoacetate ETHYL ACETOACETATE (1,2,3,4-13C4) ETHYL 3-OXOBUTANATE(1,2,3,4-13C4) ETHYL ACETOACETATE-1,2,3,4-13C4, 99 ATOM % 13C | [Molecular Formula]
C6H10O3 | [MDL Number]
MFCD00083958 | [MOL File]
84508-55-4.mol | [Molecular Weight]
134.18 |
| Chemical Properties | Back Directory | [Melting point ]
−43 °C(lit.) | [Boiling point ]
181 °C(lit.) | [density ]
1.052 g/mL at 25 °C | [refractive index ]
n20/D 1.419(lit.) | [Fp ]
184 °F | [storage temp. ]
Refrigerator | [solubility ]
Chloroform (Soluble), Ethyl Acetate (Slightly), Methanol (Slightly) | [form ]
Oil | [color ]
Colourless | [InChI]
1S/C6H10O3/c1-3-9-6(8)4-5(2)7/h3-4H2,1-2H3/i2+1,4+1,5+1,6+1 | [InChIKey]
XYIBRDXRRQCHLP-XMUWKQMQSA-N | [SMILES]
CCO[13C](=O)[13CH2][13C]([13CH3])=O | [CAS Number Unlabeled]
141-97-9 |
| Hazard Information | Back Directory | [Chemical Properties]
ETHYL ACETOACETATE (1,2,3,4-13C4) is Clear Colourless Oil
| [Uses]
ETHYL ACETOACETATE (1,2,3,4-13C4) is the isotope labelled analog of Ethyl Acetoacetate, an chemical intermediate used in the production of various analgesics, antibiotics and antimalarial agents.
| [Uses]
Ethyl Acetoacetate-13C4 is the isotope labelled analog of Ethyl Acetoacetate (E899545(P)), a chemical intermediate used in the production of various analgesics, antibiotics and antimalarial agents. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|