| Identification | Back Directory | [Name]
NONAFLUOROHEXYLTRIMETHOXYSILANE | [CAS]
85877-79-8 | [Synonyms]
Dow Corning B 3958 NONAFLUOROHEXYLTRIMETHOXYSILANE Nonafluorobutylethyltrimethoxysilane 1H,1H,2H,2H-NonafluorohexylTrimethoxysilane Trimethoxy(1H,1H,2H,2H-perfluorohexyl)silane TriMethoxy(1H,1H,2H,2H-nonafluorohexyl)silane 3,3,4,4,5,5,6,6,6-Nonafluorohexyltrimethoxysilane Nonafluoro-1,1,2,2-tetrahydrohexyltrimethoxysilane (1,1,2,2-Tetrahydrononafluorohexyl)trimethoxysilane triMethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane Silane, trimethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)- Trimethoxy(1H,1H,2H,2H-nonafluorohexyl)silane | [EINECS(EC#)]
248-418-4 | [Molecular Formula]
C9H13F9O3Si | [MDL Number]
MFCD08275518 | [MOL File]
85877-79-8.mol | [Molecular Weight]
368.27 |
| Chemical Properties | Back Directory | [Boiling point ]
68-9°C/15mmHg | [density ]
1,335 g/cm3 | [refractive index ]
1.3376 | [Fp ]
71°C(lit.) | [form ]
clear liquid | [color ]
Colorless to Almost colorless | [Specific Gravity]
1.335 | [Hydrolytic Sensitivity]
7: reacts slowly with moisture/water | [InChI]
InChI=1S/C9H13F9O3Si/c1-19-22(20-2,21-3)5-4-6(10,11)7(12,13)8(14,15)9(16,17)18/h4-5H2,1-3H3 | [InChIKey]
IJROHELDTBDTPH-UHFFFAOYSA-N | [SMILES]
[Si](OC)(OC)(OC)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F | [EPA Substance Registry System]
((Perfluorobutyl)ethyl)trimethoxysilane (85877-79-8) |
|
|