| Identification | Back Directory | [Name]
2,4-dimethanidylpentane, ruthenium | [CAS]
85908-78-7 | [Synonyms]
2,4-dimethanidylpentane, ruthenium Bis(η5-2,4-dimethylpentadienyl)ruthenium(Ⅱ) BIS(H5-2,4-DIMETHYLPENTADIENYL)RUTHENIUM(II) Bis(2,4-diMethylpentadienyl)rutheniuM(II),99% | [Molecular Formula]
2C7H9.Ru | [MDL Number]
MFCD11840319 | [MOL File]
85908-78-7.mol | [Molecular Weight]
287.366 |
| Chemical Properties | Back Directory | [Melting point ]
85°C | [form ]
solid | [color ]
yellow | [InChI]
1S/2C7H11.Ru/c2*1-6(2)5-7(3)4;/h2*5H,1,3H2,2,4H3; | [InChIKey]
ZOLKMBFKHJHDCJ-UHFFFAOYSA-N | [SMILES]
[Ru].[CH2][C](C)[CH][C]([CH2])C.[CH2][C](C)[CH][C]([CH2])C |
| Questions And Answer | Back Directory | [Uses]
As volatile ruthenium complex, Bis(2,4-dimethylpentadienyl)ruthenium can be useful for the MOCVD of ruthenium and ruthenium oxide.
|
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
|