| Identification | Back Directory | [Name]
O-Desethyl Candesartan Cilexetil
| [CAS]
869631-11-8 | [Synonyms]
Candesartan EP Imp B Candesartan Impurity II Candesartan Impurity 1 Candesartan EP Impurity B candesartan cilexetil impurity1358 O-Desethyl Candesartan Cilexetil
Candesartan Cilexetil EP IMpurity B Candesartan Cilexetil O-Desethyl Analog Candesartan Cilexetil USP Related Compound B Candesartan Cilexetil Impurity 2(EP Impurity B) Candesartan Cilexetil EP Impurity B (Desethyl Candesartan Cilexetil) Candesartan Cilexetil EP Impurity B (Candesartan Cilexetil O-Desethyl Analog) Candesartan Cilexetil Related Compound B (1-(Cyclohexyloxycarbonyloxy)ethyl 1-{[2''-(1H- tetrazol-5- (1087825) 1-cyclohexyloxycarbonyloxyethyl 2-oxo-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-benzimidazole-4-carboxylate 1-(Cyclohexyloxycarbonyloxy)ethyl 1-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl) methyl)-2-hydroxy-1H-benzo[d]imidazole-7-carboxylate 1-(((cyclohexyloxy)carbonyl)oxy)ethyl 3-((2'-(2H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)methyl) -2-oxo-2,3-dihydro-1H-benzo[d]imidazole-4-carboxylate 2,3-Dihydro-2-oxo-3-[[2'-(2H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]Methyl]-1H-benziMidazole-4-carboxylic Acid 1-[[(Cyclohexyloxy)carbonyl]oxy]ethyl Ester 1H-Benzimidazole-4-carboxylic acid, 2,3-dihydro-2-oxo-3-[[2'-(2H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]-, 1-[[(cyclohexyloxy)carbonyl]oxy]ethyl ester Candesartan Cilexetil ImpuritⅠ: O-Desethyl Candesartan Cilexetil( 2,3-Dihydro-2-oxo-3-[[2'-(2H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]-1H-benzimidazole-4-carboxylic Acid 1-[[(Cyclohexyloxy)carbonyl]oxy]ethyl Ester) Candesartan Cilexetil ImpuritⅠ: O-Desethyl Candesartan Cilexetil( 2,3-Dihydro-2-oxo-3-[[2’-(2H-tetrazol-5-yl)[1,1’-biphenyl]-4-yl]methyl]-1H-benzimidazole-4-carboxylic Acid 1-[[(Cyclohexyloxy)carbonyl]oxy]ethyl Ester) Candesartan Cilexetil EP impurity BQ: What is
Candesartan Cilexetil EP impurity B Q: What is the CAS Number of
Candesartan Cilexetil EP impurity B Q: What is the storage condition of
Candesartan Cilexetil EP impurity B Q: What are the applications of
Candesartan Cilexetil EP impurity B | [Molecular Formula]
C31H30N6O6 | [MDL Number]
MFCD18379331 | [MOL File]
869631-11-8.mol | [Molecular Weight]
582.61 |
| Chemical Properties | Back Directory | [Melting point ]
237-239?C (dec.) | [density ]
1.43±0.1 g/cm3(Predicted) | [storage temp. ]
Refrigerator | [solubility ]
DMSO (Slightly), Methanol (Slightly) | [form ]
Solid | [pka]
4.16±0.10(Predicted) | [color ]
White | [Major Application]
pharmaceutical | [InChIKey]
UEJMFQHOVKQHHB-UHFFFAOYSA-N | [SMILES]
[nH]1nnc(n1)c2c(cccc2)c3ccc(cc3)C[n]4c5c(nc4O)cccc5C(=O)OC(OC(=O)OC6CCCCC6)C |
| Hazard Information | Back Directory | [Chemical Properties]
White Solid | [Uses]
O-Desethyl Candesartan Cilexetil (Candesartan Cilexetil EP Impurity B) is used for the preparation of Candesartan Cilexetil (CAT# C175580), which is an antihypertensive. It may be obtained as a degradation product of Candesartan Cilexetil in liquid chromatography studies. | [Uses]
O-Desethyl Candesartan Cilexetil can be used for the preparation of Candesartan cilexetil.
|
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
|