| Identification | Back Directory | [Name]
(1S,2S)-1,2-Bis(2-hydroxyphenyl)ethylenediaMine | [CAS]
870991-68-7 | [Synonyms]
2,2'-[(1S,2S)-1,2-Diaminoethylene]bisphenol 2,2-[(1S,2S)-1,2-Diamino-1,2-ethanediyl]bisphenol (1S,2S)-1,2-Diamino-1,2-bis(2-hydroxyphenyl)ethane (1S,2S)-1,2-Bis(2-hydroxyphenyl)ethylenediamine > (1S,2S)-1,2-Bis(2-hydroxyphenyl)ethylenediamine Phenol, 2,?2'-?[(1S,?2S)?-?1,?2-?diamino-?1,?2-?ethanediyl]?bis- | [Molecular Formula]
C14H16N2O2 | [MOL File]
870991-68-7.mol | [Molecular Weight]
244.289 |
| Chemical Properties | Back Directory | [Melting point ]
159 °C(dec.) | [solubility ]
slightly sol. in Chloroform | [form ]
powder to crystal | [color ]
White to Light yellow to Light orange | [Optical Rotation]
[α]22/D -65°, c =0.2 in chloroform | [InChI]
1S/C14H16N2O2/c15-13(9-5-1-3-7-11(9)17)14(16)10-6-2-4-8-12(10)18/h1-8,13-14,17-18H,15-16H2/t13-,14-/m0/s1 | [InChIKey]
MRNPLGLZBUDMRE-KBPBESRZSA-N | [SMILES]
N[C@H]([C@@H](N)c1ccccc1O)c2ccccc2O |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
TCI Chemicals
|
| Tel: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
|